C28H36N2O2 — CID 66710031
N-(3-methylcyclohexyl)-4-[4-[(3-methylcyclohexyl)carbamoyl]phenyl]benzamide (PubChem CID 66710031) has the molecular formula C28H36N2O2 and a molecular weight of 432.61 g/mol. Its IUPAC name is N-(3-methylcyclohexyl)-4-[4-[(3-methylcyclohexyl)carbamoyl]phenyl]benzamide.
| Compound Name | N-(3-methylcyclohexyl)-4-[4-[(3-methylcyclohexyl)carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 66710031 |
| Molecular Formula | C28H36N2O2 |
| Molecular Weight | 432.61 g/mol |
| Exact Mass | 432.28 |
| IUPAC Name | N-(3-methylcyclohexyl)-4-[4-[(3-methylcyclohexyl)carbamoyl]phenyl]benzamide |
| SMILES | CC1CCCC(NC(=O)c2ccc(-c3ccc(C(=O)NC4CCCC(C)C4)cc3)cc2)C1 |
| InChI | InChI=1S/C28H36N2O2/c1-19-5-3-7-25(17-19)29-27(31)23-13-9-21(10-14-23)22-11-15-24(16-12-22)28(32)30-26-8-4-6-20(2)18-26/h9-16,19-20,25-26H,3-8,17-18H2,1-2H3,(H,29,31)(H,30,32) |
| InChIKey | MIYJUYDEYUWEDD-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.61 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |