C30H45N3O3 — CID 141437065
1-N,2-N,3-N-tris(3-methylcyclohexyl)benzene-1,2,3-tricarboxamide (PubChem CID 141437065) has the molecular formula C30H45N3O3 and a molecular weight of 495.71 g/mol. Its IUPAC name is 1-N,2-N,3-N-tris(3-methylcyclohexyl)benzene-1,2,3-tricarboxamide.
| Compound Name | 1-N,2-N,3-N-tris(3-methylcyclohexyl)benzene-1,2,3-tricarboxamide |
|---|---|
| PubChem CID | 141437065 |
| Molecular Formula | C30H45N3O3 |
| Molecular Weight | 495.71 g/mol |
| Exact Mass | 495.35 |
| IUPAC Name | 1-N,2-N,3-N-tris(3-methylcyclohexyl)benzene-1,2,3-tricarboxamide |
| SMILES | CC1CCCC(NC(=O)c2cccc(C(=O)NC3CCCC(C)C3)c2C(=O)NC2CCCC(C)C2)C1 |
| InChI | InChI=1S/C30H45N3O3/c1-19-8-4-11-22(16-19)31-28(34)25-14-7-15-26(29(35)32-23-12-5-9-20(2)17-23)27(25)30(36)33-24-13-6-10-21(3)18-24/h7,14-15,19-24H,4-6,8-13,16-18H2,1-3H3,(H,31,34)(H,32,35)(H,33,36) |
| InChIKey | DUCODZBZECKGIG-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.71 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |