C14H18FNO — CID 41097249
2-fluoro-N-[(1R,3S)-3-methylcyclohexyl]benzamide (PubChem CID 41097249) has the molecular formula C14H18FNO and a molecular weight of 235.30 g/mol. Its IUPAC name is 2-fluoro-N-[(1R,3S)-3-methylcyclohexyl]benzamide.
| Compound Name | 2-fluoro-N-[(1R,3S)-3-methylcyclohexyl]benzamide |
|---|---|
| PubChem CID | 41097249 |
| Molecular Formula | C14H18FNO |
| Molecular Weight | 235.30 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 2-fluoro-N-[(1R,3S)-3-methylcyclohexyl]benzamide |
| SMILES | C[C@H]1CCC[C@@H](NC(=O)c2ccccc2F)C1 |
| InChI | InChI=1S/C14H18FNO/c1-10-5-4-6-11(9-10)16-14(17)12-7-2-3-8-13(12)15/h2-3,7-8,10-11H,4-6,9H2,1H3,(H,16,17)/t10-,11+/m0/s1 |
| InChIKey | NDNWNFDBNWNMQG-WDEREUQCSA-N |
| XLogP | 3.13 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.30 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |