C16H29NO3S — CID 111912577
N-(2-ethylsulfinylcyclohexyl)-2-(1-hydroxycyclohexyl)acetamide (PubChem CID 111912577) has the molecular formula C16H29NO3S and a molecular weight of 315.48 g/mol. Its IUPAC name is N-(2-ethylsulfinylcyclohexyl)-2-(1-hydroxycyclohexyl)acetamide.
| Compound Name | N-(2-ethylsulfinylcyclohexyl)-2-(1-hydroxycyclohexyl)acetamide |
|---|---|
| PubChem CID | 111912577 |
| Molecular Formula | C16H29NO3S |
| Molecular Weight | 315.48 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | N-(2-ethylsulfinylcyclohexyl)-2-(1-hydroxycyclohexyl)acetamide |
| SMILES | CCS(=O)C1CCCCC1NC(=O)CC1(O)CCCCC1 |
| InChI | InChI=1S/C16H29NO3S/c1-2-21(20)14-9-5-4-8-13(14)17-15(18)12-16(19)10-6-3-7-11-16/h13-14,19H,2-12H2,1H3,(H,17,18) |
| InChIKey | DOKCWVHZXLSEIN-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.48 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |