C13H17ClF2N2O — CID 119386244
2,4-difluoro-5-methyl-N-piperidin-4-ylbenzamide;hydrochloride (PubChem CID 119386244) has the molecular formula C13H17ClF2N2O and a molecular weight of 290.74 g/mol. Its IUPAC name is 2,4-difluoro-5-methyl-N-piperidin-4-ylbenzamide;hydrochloride.
| Compound Name | 2,4-difluoro-5-methyl-N-piperidin-4-ylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 119386244 |
| Molecular Formula | C13H17ClF2N2O |
| Molecular Weight | 290.74 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 2,4-difluoro-5-methyl-N-piperidin-4-ylbenzamide;hydrochloride |
| SMILES | Cc1cc(C(=O)NC2CCNCC2)c(F)cc1F.Cl |
| InChI | InChI=1S/C13H16F2N2O.ClH/c1-8-6-10(12(15)7-11(8)14)13(18)17-9-2-4-16-5-3-9;/h6-7,9,16H,2-5H2,1H3,(H,17,18);1H |
| InChIKey | NYCPETHTQPKJOM-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.74 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |