C20H23FN2O — CID 119388030
4-(3,4-dimethylphenyl)-2-fluoro-N-piperidin-4-ylbenzamide (PubChem CID 119388030) has the molecular formula C20H23FN2O and a molecular weight of 326.42 g/mol. Its IUPAC name is 4-(3,4-dimethylphenyl)-2-fluoro-N-piperidin-4-ylbenzamide.
| Compound Name | 4-(3,4-dimethylphenyl)-2-fluoro-N-piperidin-4-ylbenzamide |
|---|---|
| PubChem CID | 119388030 |
| Molecular Formula | C20H23FN2O |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | 4-(3,4-dimethylphenyl)-2-fluoro-N-piperidin-4-ylbenzamide |
| SMILES | Cc1ccc(-c2ccc(C(=O)NC3CCNCC3)c(F)c2)cc1C |
| InChI | InChI=1S/C20H23FN2O/c1-13-3-4-15(11-14(13)2)16-5-6-18(19(21)12-16)20(24)23-17-7-9-22-10-8-17/h3-6,11-12,17,22H,7-10H2,1-2H3,(H,23,24) |
| InChIKey | KZIWOEAXRHNYTC-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |