C21H25FN2O — CID 120599784
4-(3,4-dimethylphenyl)-2-fluoro-N-(2-methylpiperidin-4-yl)benzamide (PubChem CID 120599784) has the molecular formula C21H25FN2O and a molecular weight of 340.44 g/mol. Its IUPAC name is 4-(3,4-dimethylphenyl)-2-fluoro-N-(2-methylpiperidin-4-yl)benzamide.
| Compound Name | 4-(3,4-dimethylphenyl)-2-fluoro-N-(2-methylpiperidin-4-yl)benzamide |
|---|---|
| PubChem CID | 120599784 |
| Molecular Formula | C21H25FN2O |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | 4-(3,4-dimethylphenyl)-2-fluoro-N-(2-methylpiperidin-4-yl)benzamide |
| SMILES | Cc1ccc(-c2ccc(C(=O)NC3CCNC(C)C3)c(F)c2)cc1C |
| InChI | InChI=1S/C21H25FN2O/c1-13-4-5-16(10-14(13)2)17-6-7-19(20(22)12-17)21(25)24-18-8-9-23-15(3)11-18/h4-7,10,12,15,18,23H,8-9,11H2,1-3H3,(H,24,25) |
| InChIKey | JJUCPYYWBKBYCI-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |