C11H12Cl2N2O — CID 79689600
2,5-dichloro-N-[(3S)-pyrrolidin-3-yl]benzamide (PubChem CID 79689600) has the molecular formula C11H12Cl2N2O and a molecular weight of 259.14 g/mol. Its IUPAC name is 2,5-dichloro-N-[(3S)-pyrrolidin-3-yl]benzamide.
| Compound Name | 2,5-dichloro-N-[(3S)-pyrrolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 79689600 |
| Molecular Formula | C11H12Cl2N2O |
| Molecular Weight | 259.14 g/mol |
| Exact Mass | 258.03 |
| IUPAC Name | 2,5-dichloro-N-[(3S)-pyrrolidin-3-yl]benzamide |
| SMILES | O=C(N[C@H]1CCNC1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C11H12Cl2N2O/c12-7-1-2-10(13)9(5-7)11(16)15-8-3-4-14-6-8/h1-2,5,8,14H,3-4,6H2,(H,15,16)/t8-/m0/s1 |
| InChIKey | HJHWRKOXHVIRHJ-QMMMGPOBSA-N |
| XLogP | 2.09 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.14 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |