C10H13BrN2O4S — CID 65388249
5-bromo-N-(2,2-dimethylcyclopropyl)-4-sulfamoylfuran-2-carboxamide (PubChem CID 65388249) has the molecular formula C10H13BrN2O4S and a molecular weight of 337.20 g/mol. Its IUPAC name is 5-bromo-N-(2,2-dimethylcyclopropyl)-4-sulfamoylfuran-2-carboxamide.
| Compound Name | 5-bromo-N-(2,2-dimethylcyclopropyl)-4-sulfamoylfuran-2-carboxamide |
|---|---|
| PubChem CID | 65388249 |
| Molecular Formula | C10H13BrN2O4S |
| Molecular Weight | 337.20 g/mol |
| Exact Mass | 335.98 |
| IUPAC Name | 5-bromo-N-(2,2-dimethylcyclopropyl)-4-sulfamoylfuran-2-carboxamide |
| SMILES | CC1(C)CC1NC(=O)c1cc(S(N)(=O)=O)c(Br)o1 |
| InChI | InChI=1S/C10H13BrN2O4S/c1-10(2)4-7(10)13-9(14)5-3-6(8(11)17-5)18(12,15)16/h3,7H,4H2,1-2H3,(H,13,14)(H2,12,15,16) |
| InChIKey | SRRMONQLKGCTRM-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 102.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.20 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |