C10H15BrN2O6S2 — CID 79558158
5-bromo-N-(2-methyl-2-methylsulfonylpropyl)-4-sulfamoylfuran-2-carboxamide (PubChem CID 79558158) has the molecular formula C10H15BrN2O6S2 and a molecular weight of 403.28 g/mol. Its IUPAC name is 5-bromo-N-(2-methyl-2-methylsulfonylpropyl)-4-sulfamoylfuran-2-carboxamide.
| Compound Name | 5-bromo-N-(2-methyl-2-methylsulfonylpropyl)-4-sulfamoylfuran-2-carboxamide |
|---|---|
| PubChem CID | 79558158 |
| Molecular Formula | C10H15BrN2O6S2 |
| Molecular Weight | 403.28 g/mol |
| Exact Mass | 401.96 |
| IUPAC Name | 5-bromo-N-(2-methyl-2-methylsulfonylpropyl)-4-sulfamoylfuran-2-carboxamide |
| SMILES | CC(C)(CNC(=O)c1cc(S(N)(=O)=O)c(Br)o1)S(C)(=O)=O |
| InChI | InChI=1S/C10H15BrN2O6S2/c1-10(2,20(3,15)16)5-13-9(14)6-4-7(8(11)19-6)21(12,17)18/h4H,5H2,1-3H3,(H,13,14)(H2,12,17,18) |
| InChIKey | VWQQAJMUPVBNOO-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 136.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.28 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |