C9H13BrN2O5S2 — CID 113484536
5-bromo-N-(2-methylsulfinylpropyl)-4-sulfamoylfuran-2-carboxamide (PubChem CID 113484536) has the molecular formula C9H13BrN2O5S2 and a molecular weight of 373.25 g/mol. Its IUPAC name is 5-bromo-N-(2-methylsulfinylpropyl)-4-sulfamoylfuran-2-carboxamide.
| Compound Name | 5-bromo-N-(2-methylsulfinylpropyl)-4-sulfamoylfuran-2-carboxamide |
|---|---|
| PubChem CID | 113484536 |
| Molecular Formula | C9H13BrN2O5S2 |
| Molecular Weight | 373.25 g/mol |
| Exact Mass | 371.94 |
| IUPAC Name | 5-bromo-N-(2-methylsulfinylpropyl)-4-sulfamoylfuran-2-carboxamide |
| SMILES | CC(CNC(=O)c1cc(S(N)(=O)=O)c(Br)o1)S(C)=O |
| InChI | InChI=1S/C9H13BrN2O5S2/c1-5(18(2)14)4-12-9(13)6-3-7(8(10)17-6)19(11,15)16/h3,5H,4H2,1-2H3,(H,12,13)(H2,11,15,16) |
| InChIKey | LGLZWZMCLXXYGG-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 119.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.25 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |