C10H15BrN2O5S — CID 112754747
5-bromo-N-(2-methoxypropyl)-N-methyl-4-sulfamoylfuran-2-carboxamide (PubChem CID 112754747) has the molecular formula C10H15BrN2O5S and a molecular weight of 355.21 g/mol. Its IUPAC name is 5-bromo-N-(2-methoxypropyl)-N-methyl-4-sulfamoylfuran-2-carboxamide.
| Compound Name | 5-bromo-N-(2-methoxypropyl)-N-methyl-4-sulfamoylfuran-2-carboxamide |
|---|---|
| PubChem CID | 112754747 |
| Molecular Formula | C10H15BrN2O5S |
| Molecular Weight | 355.21 g/mol |
| Exact Mass | 353.99 |
| IUPAC Name | 5-bromo-N-(2-methoxypropyl)-N-methyl-4-sulfamoylfuran-2-carboxamide |
| SMILES | COC(C)CN(C)C(=O)c1cc(S(N)(=O)=O)c(Br)o1 |
| InChI | InChI=1S/C10H15BrN2O5S/c1-6(17-3)5-13(2)10(14)7-4-8(9(11)18-7)19(12,15)16/h4,6H,5H2,1-3H3,(H2,12,15,16) |
| InChIKey | OPWYBRDDSZJZHU-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 102.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.21 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |