C8H10BrNO6S — CID 65381468
2-methoxyethyl 5-bromo-4-sulfamoylfuran-2-carboxylate (PubChem CID 65381468) has the molecular formula C8H10BrNO6S and a molecular weight of 328.14 g/mol. Its IUPAC name is 2-methoxyethyl 5-bromo-4-sulfamoylfuran-2-carboxylate.
| Compound Name | 2-methoxyethyl 5-bromo-4-sulfamoylfuran-2-carboxylate |
|---|---|
| PubChem CID | 65381468 |
| Molecular Formula | C8H10BrNO6S |
| Molecular Weight | 328.14 g/mol |
| Exact Mass | 326.94 |
| IUPAC Name | 2-methoxyethyl 5-bromo-4-sulfamoylfuran-2-carboxylate |
| SMILES | COCCOC(=O)c1cc(S(N)(=O)=O)c(Br)o1 |
| InChI | InChI=1S/C8H10BrNO6S/c1-14-2-3-15-8(11)5-4-6(7(9)16-5)17(10,12)13/h4H,2-3H2,1H3,(H2,10,12,13) |
| InChIKey | NUVJCBFDSMACOK-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.14 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|