C17H22Cl2N2OS — CID 7039698
3,4-dichloro-N-[[(1R,5S)-3,3,5-trimethylcyclohexyl]carbamothioyl]benzamide (PubChem CID 7039698) has the molecular formula C17H22Cl2N2OS and a molecular weight of 373.35 g/mol. Its IUPAC name is 3,4-dichloro-N-[[(1R,5S)-3,3,5-trimethylcyclohexyl]carbamothioyl]benzamide.
| Compound Name | 3,4-dichloro-N-[[(1R,5S)-3,3,5-trimethylcyclohexyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 7039698 |
| Molecular Formula | C17H22Cl2N2OS |
| Molecular Weight | 373.35 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | 3,4-dichloro-N-[[(1R,5S)-3,3,5-trimethylcyclohexyl]carbamothioyl]benzamide |
| SMILES | C[C@@H]1C[C@@H](NC(=S)NC(=O)c2ccc(Cl)c(Cl)c2)CC(C)(C)C1 |
| InChI | InChI=1S/C17H22Cl2N2OS/c1-10-6-12(9-17(2,3)8-10)20-16(23)21-15(22)11-4-5-13(18)14(19)7-11/h4-5,7,10,12H,6,8-9H2,1-3H3,(H2,20,21,22,23)/t10-,12-/m1/s1 |
| InChIKey | DHJWDBHGJIZTON-ZYHUDNBSSA-N |
| XLogP | 4.81 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.35 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|