C11H21NO — CID 67074228
N-[(1R,5S)-3,3,5-trimethylcyclohexyl]acetamide (PubChem CID 67074228) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is N-[(1R,5S)-3,3,5-trimethylcyclohexyl]acetamide.
| Compound Name | N-[(1R,5S)-3,3,5-trimethylcyclohexyl]acetamide |
|---|---|
| PubChem CID | 67074228 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | N-[(1R,5S)-3,3,5-trimethylcyclohexyl]acetamide |
| SMILES | CC(=O)N[C@@H]1C[C@@H](C)CC(C)(C)C1 |
| InChI | InChI=1S/C11H21NO/c1-8-5-10(12-9(2)13)7-11(3,4)6-8/h8,10H,5-7H2,1-4H3,(H,12,13)/t8-,10-/m1/s1 |
| InChIKey | NEEGPDFDTZHLLU-PSASIEDQSA-N |
| XLogP | 2.34 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |