C26H50N4O2 — CID 25406909
1-[(1R,5S)-3,3,5-trimethylcyclohexyl]-3-[6-[[(1R,5S)-3,3,5-trimethylcyclohexyl]carbamoylamino]hexyl]urea (PubChem CID 25406909) has the molecular formula C26H50N4O2 and a molecular weight of 450.71 g/mol. Its IUPAC name is 1-[(1R,5S)-3,3,5-trimethylcyclohexyl]-3-[6-[[(1R,5S)-3,3,5-trimethylcyclohexyl]carbamoylamino]hexyl]urea.
| Compound Name | 1-[(1R,5S)-3,3,5-trimethylcyclohexyl]-3-[6-[[(1R,5S)-3,3,5-trimethylcyclohexyl]carbamoylamino]hexyl]urea |
|---|---|
| PubChem CID | 25406909 |
| Molecular Formula | C26H50N4O2 |
| Molecular Weight | 450.71 g/mol |
| Exact Mass | 450.39 |
| IUPAC Name | 1-[(1R,5S)-3,3,5-trimethylcyclohexyl]-3-[6-[[(1R,5S)-3,3,5-trimethylcyclohexyl]carbamoylamino]hexyl]urea |
| SMILES | C[C@@H]1C[C@@H](NC(=O)NCCCCCCNC(=O)N[C@@H]2C[C@@H](C)CC(C)(C)C2)CC(C)(C)C1 |
| InChI | InChI=1S/C26H50N4O2/c1-19-13-21(17-25(3,4)15-19)29-23(31)27-11-9-7-8-10-12-28-24(32)30-22-14-20(2)16-26(5,6)18-22/h19-22H,7-18H2,1-6H3,(H2,27,29,31)(H2,28,30,32)/t19-,20-,21-,22-/m1/s1 |
| InChIKey | RSXICVZWVHYNBS-GXRSIYKFSA-N |
| XLogP | 5.57 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.71 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|