C13H24N2O2 — CID 121317359
N'-(3,3,5-trimethylcyclohexyl)butanediamide (PubChem CID 121317359) has the molecular formula C13H24N2O2 and a molecular weight of 240.35 g/mol. Its IUPAC name is N'-(3,3,5-trimethylcyclohexyl)butanediamide.
| Compound Name | N'-(3,3,5-trimethylcyclohexyl)butanediamide |
|---|---|
| PubChem CID | 121317359 |
| Molecular Formula | C13H24N2O2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.18 |
| IUPAC Name | N'-(3,3,5-trimethylcyclohexyl)butanediamide |
| SMILES | CC1CC(NC(=O)CCC(N)=O)CC(C)(C)C1 |
| InChI | InChI=1S/C13H24N2O2/c1-9-6-10(8-13(2,3)7-9)15-12(17)5-4-11(14)16/h9-10H,4-8H2,1-3H3,(H2,14,16)(H,15,17) |
| InChIKey | YZIXBWHJCOYSAB-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |