C26H42N4O2 — CID 27235182
1-[(1R,5S)-3,3,5-trimethylcyclohexyl]-3-[3-[[(1R,5S)-3,3,5-trimethylcyclohexyl]carbamoylamino]phenyl]urea (PubChem CID 27235182) has the molecular formula C26H42N4O2 and a molecular weight of 442.65 g/mol. Its IUPAC name is 1-[(1R,5S)-3,3,5-trimethylcyclohexyl]-3-[3-[[(1R,5S)-3,3,5-trimethylcyclohexyl]carbamoylamino]phenyl]urea.
| Compound Name | 1-[(1R,5S)-3,3,5-trimethylcyclohexyl]-3-[3-[[(1R,5S)-3,3,5-trimethylcyclohexyl]carbamoylamino]phenyl]urea |
|---|---|
| PubChem CID | 27235182 |
| Molecular Formula | C26H42N4O2 |
| Molecular Weight | 442.65 g/mol |
| Exact Mass | 442.33 |
| IUPAC Name | 1-[(1R,5S)-3,3,5-trimethylcyclohexyl]-3-[3-[[(1R,5S)-3,3,5-trimethylcyclohexyl]carbamoylamino]phenyl]urea |
| SMILES | C[C@@H]1C[C@@H](NC(=O)Nc2cccc(NC(=O)N[C@@H]3C[C@@H](C)CC(C)(C)C3)c2)CC(C)(C)C1 |
| InChI | InChI=1S/C26H42N4O2/c1-17-10-21(15-25(3,4)13-17)29-23(31)27-19-8-7-9-20(12-19)28-24(32)30-22-11-18(2)14-26(5,6)16-22/h7-9,12,17-18,21-22H,10-11,13-16H2,1-6H3,(H2,27,29,31)(H2,28,30,32)/t17-,18-,21-,22-/m1/s1 |
| InChIKey | YXOHRYLHCVUPMD-MCEIDBOGSA-N |
| XLogP | 6.36 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.65 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |