C24H48N4O2 — CID 102304499
1-hexyl-3-[3-[(hexylcarbamoylamino)methyl]-3,5,5-trimethylcyclohexyl]urea (PubChem CID 102304499) has the molecular formula C24H48N4O2 and a molecular weight of 424.67 g/mol. Its IUPAC name is 1-hexyl-3-[3-[(hexylcarbamoylamino)methyl]-3,5,5-trimethylcyclohexyl]urea.
| Compound Name | 1-hexyl-3-[3-[(hexylcarbamoylamino)methyl]-3,5,5-trimethylcyclohexyl]urea |
|---|---|
| PubChem CID | 102304499 |
| Molecular Formula | C24H48N4O2 |
| Molecular Weight | 424.67 g/mol |
| Exact Mass | 424.38 |
| IUPAC Name | 1-hexyl-3-[3-[(hexylcarbamoylamino)methyl]-3,5,5-trimethylcyclohexyl]urea |
| SMILES | CCCCCCNC(=O)NCC1(C)CC(NC(=O)NCCCCCC)CC(C)(C)C1 |
| InChI | InChI=1S/C24H48N4O2/c1-6-8-10-12-14-25-21(29)27-19-24(5)17-20(16-23(3,4)18-24)28-22(30)26-15-13-11-9-7-2/h20H,6-19H2,1-5H3,(H2,25,27,29)(H2,26,28,30) |
| InChIKey | VGMQNTCQOMPAEV-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.67 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|