C17H34N4O2 — CID 144717418
1-butyl-3-[[1,3,3-trimethyl-5-(methylcarbamoylamino)cyclohexyl]methyl]urea (PubChem CID 144717418) has the molecular formula C17H34N4O2 and a molecular weight of 326.49 g/mol. Its IUPAC name is 1-butyl-3-[[1,3,3-trimethyl-5-(methylcarbamoylamino)cyclohexyl]methyl]urea.
| Compound Name | 1-butyl-3-[[1,3,3-trimethyl-5-(methylcarbamoylamino)cyclohexyl]methyl]urea |
|---|---|
| PubChem CID | 144717418 |
| Molecular Formula | C17H34N4O2 |
| Molecular Weight | 326.49 g/mol |
| Exact Mass | 326.27 |
| IUPAC Name | 1-butyl-3-[[1,3,3-trimethyl-5-(methylcarbamoylamino)cyclohexyl]methyl]urea |
| SMILES | CCCCNC(=O)NCC1(C)CC(NC(=O)NC)CC(C)(C)C1 |
| InChI | InChI=1S/C17H34N4O2/c1-6-7-8-19-15(23)20-12-17(4)10-13(21-14(22)18-5)9-16(2,3)11-17/h13H,6-12H2,1-5H3,(H2,18,21,22)(H2,19,20,23) |
| InChIKey | FNWYCODLYQJEBF-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.49 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|