C16H30N2O2 — CID 118440950
N-[3-(acetamidomethyl)-3,5,5-trimethylcyclohexyl]butanamide (PubChem CID 118440950) has the molecular formula C16H30N2O2 and a molecular weight of 282.43 g/mol. Its IUPAC name is N-[3-(acetamidomethyl)-3,5,5-trimethylcyclohexyl]butanamide.
| Compound Name | N-[3-(acetamidomethyl)-3,5,5-trimethylcyclohexyl]butanamide |
|---|---|
| PubChem CID | 118440950 |
| Molecular Formula | C16H30N2O2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.23 |
| IUPAC Name | N-[3-(acetamidomethyl)-3,5,5-trimethylcyclohexyl]butanamide |
| SMILES | CCCC(=O)NC1CC(C)(C)CC(C)(CNC(C)=O)C1 |
| InChI | InChI=1S/C16H30N2O2/c1-6-7-14(20)18-13-8-15(3,4)10-16(5,9-13)11-17-12(2)19/h13H,6-11H2,1-5H3,(H,17,19)(H,18,20) |
| InChIKey | HQBNSTVYPPEPON-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |