C24H46N2O6 — CID 67181830
2-butoxyethyl N-[3-[(2-butoxyethoxycarbonylamino)methyl]-3,5,5-trimethylcyclohexyl]carbamate (PubChem CID 67181830) has the molecular formula C24H46N2O6 and a molecular weight of 458.64 g/mol. Its IUPAC name is 2-butoxyethyl N-[3-[(2-butoxyethoxycarbonylamino)methyl]-3,5,5-trimethylcyclohexyl]carbamate.
| Compound Name | 2-butoxyethyl N-[3-[(2-butoxyethoxycarbonylamino)methyl]-3,5,5-trimethylcyclohexyl]carbamate |
|---|---|
| PubChem CID | 67181830 |
| Molecular Formula | C24H46N2O6 |
| Molecular Weight | 458.64 g/mol |
| Exact Mass | 458.34 |
| IUPAC Name | 2-butoxyethyl N-[3-[(2-butoxyethoxycarbonylamino)methyl]-3,5,5-trimethylcyclohexyl]carbamate |
| SMILES | CCCCOCCOC(=O)NCC1(C)CC(NC(=O)OCCOCCCC)CC(C)(C)C1 |
| InChI | InChI=1S/C24H46N2O6/c1-6-8-10-29-12-14-31-21(27)25-19-24(5)17-20(16-23(3,4)18-24)26-22(28)32-15-13-30-11-9-7-2/h20H,6-19H2,1-5H3,(H,25,27)(H,26,28) |
| InChIKey | AEZZFAZWBAABSW-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.64 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|