C17H31N3O6 — CID 118911971
methyl N-[[5-[2-(methoxycarbonylamino)ethoxycarbonylamino]-1,3,3-trimethylcyclohexyl]methyl]carbamate (PubChem CID 118911971) has the molecular formula C17H31N3O6 and a molecular weight of 373.45 g/mol. Its IUPAC name is methyl N-[[5-[2-(methoxycarbonylamino)ethoxycarbonylamino]-1,3,3-trimethylcyclohexyl]methyl]carbamate.
| Compound Name | methyl N-[[5-[2-(methoxycarbonylamino)ethoxycarbonylamino]-1,3,3-trimethylcyclohexyl]methyl]carbamate |
|---|---|
| PubChem CID | 118911971 |
| Molecular Formula | C17H31N3O6 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | methyl N-[[5-[2-(methoxycarbonylamino)ethoxycarbonylamino]-1,3,3-trimethylcyclohexyl]methyl]carbamate |
| SMILES | COC(=O)NCCOC(=O)NC1CC(C)(C)CC(C)(CNC(=O)OC)C1 |
| InChI | InChI=1S/C17H31N3O6/c1-16(2)8-12(9-17(3,10-16)11-19-14(22)25-5)20-15(23)26-7-6-18-13(21)24-4/h12H,6-11H2,1-5H3,(H,18,21)(H,19,22)(H,20,23) |
| InChIKey | DNGUHVFIUPVNQD-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|