C33H56N4O10 — CID 90148329
2-[[3-[[2-[[5-(methoxycarbonylamino)-1,3,3-trimethylcyclohexyl]methylcarbamoyloxy]propoxycarbonylamino]methyl]-3,5,5-trimethylcyclohexyl]carbamoyloxy]ethyl prop-2-enoate (PubChem CID 90148329) has the molecular formula C33H56N4O10 and a molecular weight of 668.83 g/mol. Its IUPAC name is 2-[[3-[[2-[[5-(methoxycarbonylamino)-1,3,3-trimethylcyclohexyl]methylcarbamoyloxy]propoxycarbonylamino]methyl]-3,5,5-trimethylcyclohexyl]carbamoyloxy]ethyl prop-2-enoate.
| Compound Name | 2-[[3-[[2-[[5-(methoxycarbonylamino)-1,3,3-trimethylcyclohexyl]methylcarbamoyloxy]propoxycarbonylamino]methyl]-3,5,5-trimethylcyclohexyl]carbamoyloxy]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 90148329 |
| Molecular Formula | C33H56N4O10 |
| Molecular Weight | 668.83 g/mol |
| Exact Mass | 668.40 |
| IUPAC Name | 2-[[3-[[2-[[5-(methoxycarbonylamino)-1,3,3-trimethylcyclohexyl]methylcarbamoyloxy]propoxycarbonylamino]methyl]-3,5,5-trimethylcyclohexyl]carbamoyloxy]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOC(=O)NC1CC(C)(C)CC(C)(CNC(=O)OCC(C)OC(=O)NCC2(C)CC(NC(=O)OC)CC(C)(C)C2)C1 |
| InChI | InChI=1S/C33H56N4O10/c1-10-25(38)44-11-12-45-29(42)37-24-14-31(5,6)18-32(7,16-24)20-34-26(39)46-17-22(2)47-27(40)35-21-33(8)15-23(36-28(41)43-9)13-30(3,4)19-33/h10,22-24H,1,11-21H2,2-9H3,(H,34,39)(H,35,40)(H,36,41)(H,37,42) |
| InChIKey | VCMMRCTUDQSYOJ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 179.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.83 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|