C23H38N2O7 — CID 122597542
2-[[1,3,3-trimethyl-5-(1-prop-2-enoyloxypropan-2-yloxyamino)cyclohexyl]methylcarbamoyloxy]propyl prop-2-enoate (PubChem CID 122597542) has the molecular formula C23H38N2O7 and a molecular weight of 454.56 g/mol. Its IUPAC name is 2-[[1,3,3-trimethyl-5-(1-prop-2-enoyloxypropan-2-yloxyamino)cyclohexyl]methylcarbamoyloxy]propyl prop-2-enoate.
| Compound Name | 2-[[1,3,3-trimethyl-5-(1-prop-2-enoyloxypropan-2-yloxyamino)cyclohexyl]methylcarbamoyloxy]propyl prop-2-enoate |
|---|---|
| PubChem CID | 122597542 |
| Molecular Formula | C23H38N2O7 |
| Molecular Weight | 454.56 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | 2-[[1,3,3-trimethyl-5-(1-prop-2-enoyloxypropan-2-yloxyamino)cyclohexyl]methylcarbamoyloxy]propyl prop-2-enoate |
| SMILES | C=CC(=O)OCC(C)ONC1CC(C)(C)CC(C)(CNC(=O)OC(C)COC(=O)C=C)C1 |
| InChI | InChI=1S/C23H38N2O7/c1-8-19(26)29-12-16(3)31-21(28)24-15-23(7)11-18(10-22(5,6)14-23)25-32-17(4)13-30-20(27)9-2/h8-9,16-18,25H,1-2,10-15H2,3-7H3,(H,24,28) |
| InChIKey | UTBAYXXUYHQVKU-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.56 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|