C20H34N2O4 — CID 147175353
[4-oxo-5-[3,3,5-trimethyl-5-[(methylcarbamoylamino)methyl]cyclohexyl]pentyl] prop-2-enoate (PubChem CID 147175353) has the molecular formula C20H34N2O4 and a molecular weight of 366.50 g/mol. Its IUPAC name is [4-oxo-5-[3,3,5-trimethyl-5-[(methylcarbamoylamino)methyl]cyclohexyl]pentyl] prop-2-enoate.
| Compound Name | [4-oxo-5-[3,3,5-trimethyl-5-[(methylcarbamoylamino)methyl]cyclohexyl]pentyl] prop-2-enoate |
|---|---|
| PubChem CID | 147175353 |
| Molecular Formula | C20H34N2O4 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.25 |
| IUPAC Name | [4-oxo-5-[3,3,5-trimethyl-5-[(methylcarbamoylamino)methyl]cyclohexyl]pentyl] prop-2-enoate |
| SMILES | C=CC(=O)OCCCC(=O)CC1CC(C)(C)CC(C)(CNC(=O)NC)C1 |
| InChI | InChI=1S/C20H34N2O4/c1-6-17(24)26-9-7-8-16(23)10-15-11-19(2,3)13-20(4,12-15)14-22-18(25)21-5/h6,15H,1,7-14H2,2-5H3,(H2,21,22,25) |
| InChIKey | BYNMXBCUTUXBKZ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|