C34H53N5O10 — CID 153268686
2-prop-2-enoyloxyethyl 6-[6-[[3,3,5-trimethyl-5-[[(4-methyl-6-oxo-1H-pyrimidin-2-yl)carbamoylamino]methyl]cyclohexyl]carbamoyloxy]hexanoyloxy]hexanoate (PubChem CID 153268686) has the molecular formula C34H53N5O10 and a molecular weight of 691.82 g/mol. Its IUPAC name is 2-prop-2-enoyloxyethyl 6-[6-[[3,3,5-trimethyl-5-[[(4-methyl-6-oxo-1H-pyrimidin-2-yl)carbamoylamino]methyl]cyclohexyl]carbamoyloxy]hexanoyloxy]hexanoate.
| Compound Name | 2-prop-2-enoyloxyethyl 6-[6-[[3,3,5-trimethyl-5-[[(4-methyl-6-oxo-1H-pyrimidin-2-yl)carbamoylamino]methyl]cyclohexyl]carbamoyloxy]hexanoyloxy]hexanoate |
|---|---|
| PubChem CID | 153268686 |
| Molecular Formula | C34H53N5O10 |
| Molecular Weight | 691.82 g/mol |
| Exact Mass | 691.38 |
| IUPAC Name | 2-prop-2-enoyloxyethyl 6-[6-[[3,3,5-trimethyl-5-[[(4-methyl-6-oxo-1H-pyrimidin-2-yl)carbamoylamino]methyl]cyclohexyl]carbamoyloxy]hexanoyloxy]hexanoate |
| SMILES | C=CC(=O)OCCOC(=O)CCCCCOC(=O)CCCCCOC(=O)NC1CC(C)(C)CC(C)(CNC(=O)Nc2nc(C)cc(=O)[nH]2)C1 |
| InChI | InChI=1S/C34H53N5O10/c1-6-27(41)47-17-18-48-29(43)14-9-7-11-15-46-28(42)13-10-8-12-16-49-32(45)37-25-20-33(3,4)22-34(5,21-25)23-35-31(44)39-30-36-24(2)19-26(40)38-30/h6,19,25H,1,7-18,20-23H2,2-5H3,(H,37,45)(H3,35,36,38,39,40,44) |
| InChIKey | WWRQQWYUEXWPCH-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 204.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.82 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|