C28H40N6O9S — CID 118613764
[2,2-bis(prop-2-enoyloxymethyl)-3-[[1,3,3-trimethyl-5-[(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)carbamoylamino]cyclohexyl]methylcarbamoyloxy]propyl] prop-2-enoate (PubChem CID 118613764) has the molecular formula C28H40N6O9S and a molecular weight of 636.73 g/mol. Its IUPAC name is [2,2-bis(prop-2-enoyloxymethyl)-3-[[1,3,3-trimethyl-5-[(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)carbamoylamino]cyclohexyl]methylcarbamoyloxy]propyl] prop-2-enoate.
| Compound Name | [2,2-bis(prop-2-enoyloxymethyl)-3-[[1,3,3-trimethyl-5-[(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)carbamoylamino]cyclohexyl]methylcarbamoyloxy]propyl] prop-2-enoate |
|---|---|
| PubChem CID | 118613764 |
| Molecular Formula | C28H40N6O9S |
| Molecular Weight | 636.73 g/mol |
| Exact Mass | 636.26 |
| IUPAC Name | [2,2-bis(prop-2-enoyloxymethyl)-3-[[1,3,3-trimethyl-5-[(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)carbamoylamino]cyclohexyl]methylcarbamoyloxy]propyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(COC(=O)C=C)(COC(=O)C=C)COC(=O)NCC1(C)CC(NC(=O)Nc2nc(=S)[nH][nH]2)CC(C)(C)C1 |
| InChI | InChI=1S/C28H40N6O9S/c1-7-19(35)40-14-28(15-41-20(36)8-2,16-42-21(37)9-3)17-43-25(39)29-13-27(6)11-18(10-26(4,5)12-27)30-23(38)31-22-32-24(44)34-33-22/h7-9,18H,1-3,10-17H2,4-6H3,(H,29,39)(H4,30,31,32,33,34,38,44) |
| InChIKey | SVECKANXRMNNFN-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 202.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.73 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|