C22H26F16N2O4 — CID 88898625
2,2,3,3,4,4,5,5-octafluoropentyl N-[[1,3,3-trimethyl-5-(2,2,3,3,4,4,5,5-octafluoropentoxycarbonylamino)cyclohexyl]methyl]carbamate (PubChem CID 88898625) has the molecular formula C22H26F16N2O4 and a molecular weight of 686.40 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5-octafluoropentyl N-[[1,3,3-trimethyl-5-(2,2,3,3,4,4,5,5-octafluoropentoxycarbonylamino)cyclohexyl]methyl]carbamate.
| Compound Name | 2,2,3,3,4,4,5,5-octafluoropentyl N-[[1,3,3-trimethyl-5-(2,2,3,3,4,4,5,5-octafluoropentoxycarbonylamino)cyclohexyl]methyl]carbamate |
|---|---|
| PubChem CID | 88898625 |
| Molecular Formula | C22H26F16N2O4 |
| Molecular Weight | 686.40 g/mol |
| Exact Mass | 686.16 |
| IUPAC Name | 2,2,3,3,4,4,5,5-octafluoropentyl N-[[1,3,3-trimethyl-5-(2,2,3,3,4,4,5,5-octafluoropentoxycarbonylamino)cyclohexyl]methyl]carbamate |
| SMILES | CC1(CC(CC(C1)(C)CNC(=O)OCC(C(C(C(F)F)(F)F)(F)F)(F)F)NC(=O)OCC(C(C(C(F)F)(F)F)(F)F)(F)F)C |
| InChI | InChI=1S/C22H26F16N2O4/c1-15(2)4-10(40-14(42)44-9-18(29,30)22(37,38)20(33,34)12(25)26)5-16(3,6-15)7-39-13(41)43-8-17(27,28)21(35,36)19(31,32)11(23)24/h10-12H,4-9H2,1-3H3,(H,39,41)(H,40,42) |
| InChIKey | UKCXYCTYCXZYKB-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 76.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | 1020 |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.40 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|