C14H24F2N2O3 — CID 131993634
2,2-difluoroethyl N-[3-(formamidomethyl)-3,5,5-trimethylcyclohexyl]carbamate (PubChem CID 131993634) has the molecular formula C14H24F2N2O3 and a molecular weight of 306.35 g/mol. Its IUPAC name is 2,2-difluoroethyl N-[3-(formamidomethyl)-3,5,5-trimethylcyclohexyl]carbamate.
| Compound Name | 2,2-difluoroethyl N-[3-(formamidomethyl)-3,5,5-trimethylcyclohexyl]carbamate |
|---|---|
| PubChem CID | 131993634 |
| Molecular Formula | C14H24F2N2O3 |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 2,2-difluoroethyl N-[3-(formamidomethyl)-3,5,5-trimethylcyclohexyl]carbamate |
| SMILES | CC1(C)CC(NC(=O)OCC(F)F)CC(C)(CNC=O)C1 |
| InChI | InChI=1S/C14H24F2N2O3/c1-13(2)4-10(18-12(20)21-6-11(15)16)5-14(3,7-13)8-17-9-19/h9-11H,4-8H2,1-3H3,(H,17,19)(H,18,20) |
| InChIKey | PPUKDUOIBKYVJZ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|