C18H32N2O4 — CID 177065445
2-[[3,3,5-trimethyl-5-(methylaminomethyl)cyclohexyl]carbamoyloxy]ethyl 2-methylprop-2-enoate (PubChem CID 177065445) has the molecular formula C18H32N2O4 and a molecular weight of 340.46 g/mol. Its IUPAC name is 2-[[3,3,5-trimethyl-5-(methylaminomethyl)cyclohexyl]carbamoyloxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[[3,3,5-trimethyl-5-(methylaminomethyl)cyclohexyl]carbamoyloxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 177065445 |
| Molecular Formula | C18H32N2O4 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | 2-[[3,3,5-trimethyl-5-(methylaminomethyl)cyclohexyl]carbamoyloxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOC(=O)NC1CC(C)(C)CC(C)(CNC)C1 |
| InChI | InChI=1S/C18H32N2O4/c1-13(2)15(21)23-7-8-24-16(22)20-14-9-17(3,4)11-18(5,10-14)12-19-6/h14,19H,1,7-12H2,2-6H3,(H,20,22) |
| InChIKey | GFSHEQALRFVOBI-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|