C36H62N4O9 — CID 122658969
2-[[3,3,5-trimethyl-5-[[3-[[1,3,3-trimethyl-5-[(2-propoxyacetyl)amino]cyclohexyl]methylcarbamoyloxy]propanoylamino]methyl]cyclohexyl]carbamoyloxy]ethyl 2-methylprop-2-enoate (PubChem CID 122658969) has the molecular formula C36H62N4O9 and a molecular weight of 694.91 g/mol. Its IUPAC name is 2-[[3,3,5-trimethyl-5-[[3-[[1,3,3-trimethyl-5-[(2-propoxyacetyl)amino]cyclohexyl]methylcarbamoyloxy]propanoylamino]methyl]cyclohexyl]carbamoyloxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[[3,3,5-trimethyl-5-[[3-[[1,3,3-trimethyl-5-[(2-propoxyacetyl)amino]cyclohexyl]methylcarbamoyloxy]propanoylamino]methyl]cyclohexyl]carbamoyloxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 122658969 |
| Molecular Formula | C36H62N4O9 |
| Molecular Weight | 694.91 g/mol |
| Exact Mass | 694.45 |
| IUPAC Name | 2-[[3,3,5-trimethyl-5-[[3-[[1,3,3-trimethyl-5-[(2-propoxyacetyl)amino]cyclohexyl]methylcarbamoyloxy]propanoylamino]methyl]cyclohexyl]carbamoyloxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOC(=O)NC1CC(C)(C)CC(C)(CNC(=O)CCOC(=O)NCC2(C)CC(NC(=O)COCCC)CC(C)(C)C2)C1 |
| InChI | InChI=1S/C36H62N4O9/c1-10-12-46-20-29(42)39-26-16-33(4,5)22-36(9,18-26)24-38-31(44)48-13-11-28(41)37-23-35(8)19-27(17-34(6,7)21-35)40-32(45)49-15-14-47-30(43)25(2)3/h26-27H,2,10-24H2,1,3-9H3,(H,37,41)(H,38,44)(H,39,42)(H,40,45) |
| InChIKey | QFMOASMHLFGASC-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 170.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.91 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|