C34H64N2O11Si2 — CID 177065437
2-[3-[[methoxy(dimethyl)silyl]oxy-dimethylsilyl]propoxy]ethyl 6-[[1,3,3-trimethyl-5-[2-(2-methylprop-2-enoyloxy)ethoxycarbonylamino]cyclohexyl]methylcarbamoyloxy]hexanoate (PubChem CID 177065437) has the molecular formula C34H64N2O11Si2 and a molecular weight of 733.06 g/mol. Its IUPAC name is 2-[3-[[methoxy(dimethyl)silyl]oxy-dimethylsilyl]propoxy]ethyl 6-[[1,3,3-trimethyl-5-[2-(2-methylprop-2-enoyloxy)ethoxycarbonylamino]cyclohexyl]methylcarbamoyloxy]hexanoate.
| Compound Name | 2-[3-[[methoxy(dimethyl)silyl]oxy-dimethylsilyl]propoxy]ethyl 6-[[1,3,3-trimethyl-5-[2-(2-methylprop-2-enoyloxy)ethoxycarbonylamino]cyclohexyl]methylcarbamoyloxy]hexanoate |
|---|---|
| PubChem CID | 177065437 |
| Molecular Formula | C34H64N2O11Si2 |
| Molecular Weight | 733.06 g/mol |
| Exact Mass | 732.40 |
| IUPAC Name | 2-[3-[[methoxy(dimethyl)silyl]oxy-dimethylsilyl]propoxy]ethyl 6-[[1,3,3-trimethyl-5-[2-(2-methylprop-2-enoyloxy)ethoxycarbonylamino]cyclohexyl]methylcarbamoyloxy]hexanoate |
| SMILES | C=C(C)C(=O)OCCOC(=O)NC1CC(C)(C)CC(C)(CNC(=O)OCCCCCC(=O)OCCOCCC[Si](C)(C)O[Si](C)(C)OC)C1 |
| InChI | InChI=1S/C34H64N2O11Si2/c1-27(2)30(38)44-20-21-46-32(40)36-28-23-33(3,4)25-34(5,24-28)26-35-31(39)45-17-13-11-12-15-29(37)43-19-18-42-16-14-22-48(7,8)47-49(9,10)41-6/h28H,1,11-26H2,2-10H3,(H,35,39)(H,36,40) |
| InChIKey | XRLPNILSMLFSAU-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 156.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.06 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|