C21H36N2O6 — CID 153361076
2-[[1,3,3-trimethyl-5-(propan-2-yloxycarbonylamino)cyclohexyl]methylcarbamoyloxy]ethyl 2-methylprop-2-enoate (PubChem CID 153361076) has the molecular formula C21H36N2O6 and a molecular weight of 412.53 g/mol. Its IUPAC name is 2-[[1,3,3-trimethyl-5-(propan-2-yloxycarbonylamino)cyclohexyl]methylcarbamoyloxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[[1,3,3-trimethyl-5-(propan-2-yloxycarbonylamino)cyclohexyl]methylcarbamoyloxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 153361076 |
| Molecular Formula | C21H36N2O6 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | 2-[[1,3,3-trimethyl-5-(propan-2-yloxycarbonylamino)cyclohexyl]methylcarbamoyloxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOC(=O)NCC1(C)CC(NC(=O)OC(C)C)CC(C)(C)C1 |
| InChI | InChI=1S/C21H36N2O6/c1-14(2)17(24)27-8-9-28-18(25)22-13-21(7)11-16(10-20(5,6)12-21)23-19(26)29-15(3)4/h15-16H,1,8-13H2,2-7H3,(H,22,25)(H,23,26) |
| InChIKey | ALEUQCMJKNAWFB-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|