C25H38N2O9 — CID 89121031
[3-prop-2-enoyloxy-2-[[3,3,5-trimethyl-5-[(oxiran-2-ylmethoxycarbonylamino)methyl]cyclohexyl]carbamoyloxy]propyl] 2-methylprop-2-enoate (PubChem CID 89121031) has the molecular formula C25H38N2O9 and a molecular weight of 510.58 g/mol. Its IUPAC name is [3-prop-2-enoyloxy-2-[[3,3,5-trimethyl-5-[(oxiran-2-ylmethoxycarbonylamino)methyl]cyclohexyl]carbamoyloxy]propyl] 2-methylprop-2-enoate.
| Compound Name | [3-prop-2-enoyloxy-2-[[3,3,5-trimethyl-5-[(oxiran-2-ylmethoxycarbonylamino)methyl]cyclohexyl]carbamoyloxy]propyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 89121031 |
| Molecular Formula | C25H38N2O9 |
| Molecular Weight | 510.58 g/mol |
| Exact Mass | 510.26 |
| IUPAC Name | [3-prop-2-enoyloxy-2-[[3,3,5-trimethyl-5-[(oxiran-2-ylmethoxycarbonylamino)methyl]cyclohexyl]carbamoyloxy]propyl] 2-methylprop-2-enoate |
| SMILES | C=CC(=O)OCC(COC(=O)C(=C)C)OC(=O)NC1CC(C)(C)CC(C)(CNC(=O)OCC2CO2)C1 |
| InChI | InChI=1S/C25H38N2O9/c1-7-20(28)33-12-19(13-34-21(29)16(2)3)36-23(31)27-17-8-24(4,5)14-25(6,9-17)15-26-22(30)35-11-18-10-32-18/h7,17-19H,1-2,8-15H2,3-6H3,(H,26,30)(H,27,31) |
| InChIKey | CZZLOSGYNBJWGX-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 141.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.58 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|