C22H32N2O7 — CID 143915573
[2-[[3-(cyanatomethyl)-3,5,5-trimethylcyclohexyl]carbamoyloxy]-3-prop-2-enoyloxypropyl] 2-methylprop-2-enoate (PubChem CID 143915573) has the molecular formula C22H32N2O7 and a molecular weight of 436.51 g/mol. Its IUPAC name is [2-[[3-(cyanatomethyl)-3,5,5-trimethylcyclohexyl]carbamoyloxy]-3-prop-2-enoyloxypropyl] 2-methylprop-2-enoate.
| Compound Name | [2-[[3-(cyanatomethyl)-3,5,5-trimethylcyclohexyl]carbamoyloxy]-3-prop-2-enoyloxypropyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 143915573 |
| Molecular Formula | C22H32N2O7 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | [2-[[3-(cyanatomethyl)-3,5,5-trimethylcyclohexyl]carbamoyloxy]-3-prop-2-enoyloxypropyl] 2-methylprop-2-enoate |
| SMILES | C=CC(=O)OCC(COC(=O)C(=C)C)OC(=O)NC1CC(C)(C)CC(C)(COC#N)C1 |
| InChI | InChI=1S/C22H32N2O7/c1-7-18(25)29-10-17(11-30-19(26)15(2)3)31-20(27)24-16-8-21(4,5)12-22(6,9-16)13-28-14-23/h7,16-17H,1-2,8-13H2,3-6H3,(H,24,27) |
| InChIKey | YKVJQKHXBKAIMQ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 123.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|