C20H28O10 — CID 159044729
[3-hydroxy-2-(2-methylprop-2-enoyloxy)propyl] 2-methylprop-2-enoate;(3-hydroxy-2-prop-2-enoyloxypropyl) prop-2-enoate (PubChem CID 159044729) has the molecular formula C20H28O10 and a molecular weight of 428.43 g/mol. Its IUPAC name is [3-hydroxy-2-(2-methylprop-2-enoyloxy)propyl] 2-methylprop-2-enoate;(3-hydroxy-2-prop-2-enoyloxypropyl) prop-2-enoate.
| Compound Name | [3-hydroxy-2-(2-methylprop-2-enoyloxy)propyl] 2-methylprop-2-enoate;(3-hydroxy-2-prop-2-enoyloxypropyl) prop-2-enoate |
|---|---|
| PubChem CID | 159044729 |
| Molecular Formula | C20H28O10 |
| Molecular Weight | 428.43 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | [3-hydroxy-2-(2-methylprop-2-enoyloxy)propyl] 2-methylprop-2-enoate;(3-hydroxy-2-prop-2-enoyloxypropyl) prop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(CO)OC(=O)C(=C)C.C=CC(=O)OCC(CO)OC(=O)C=C |
| InChI | InChI=1S/C11H16O5.C9H12O5/c1-7(2)10(13)15-6-9(5-12)16-11(14)8(3)4;1-3-8(11)13-6-7(5-10)14-9(12)4-2/h9,12H,1,3,5-6H2,2,4H3;3-4,7,10H,1-2,5-6H2 |
| InChIKey | JWMWTLWCDZWUFD-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.43 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|