C15H18O8 — CID 87307378
(Z)-4-[2,3-bis(2-methylprop-2-enoyloxy)propoxy]-4-oxobut-2-enoic acid (PubChem CID 87307378) has the molecular formula C15H18O8 and a molecular weight of 326.30 g/mol. Its IUPAC name is (Z)-4-[2,3-bis(2-methylprop-2-enoyloxy)propoxy]-4-oxobut-2-enoic acid.
| Compound Name | (Z)-4-[2,3-bis(2-methylprop-2-enoyloxy)propoxy]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 87307378 |
| Molecular Formula | C15H18O8 |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | (Z)-4-[2,3-bis(2-methylprop-2-enoyloxy)propoxy]-4-oxobut-2-enoic acid |
| SMILES | C=C(C)C(=O)OCC(COC(=O)/C=C\C(=O)O)OC(=O)C(=C)C |
| InChI | InChI=1S/C15H18O8/c1-9(2)14(19)22-8-11(23-15(20)10(3)4)7-21-13(18)6-5-12(16)17/h5-6,11H,1,3,7-8H2,2,4H3,(H,16,17)/b6-5- |
| InChIKey | GFZQJTGOFQKUBF-WAYWQWQTSA-N |
| XLogP | 0.78 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.30 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|