C20H38N3O3+ — CID 145131676
butyl-[2-[[3-(cyanatomethyl)-3,5,5-trimethylcyclohexyl]carbamoyloxy]ethyl]-dimethylazanium (PubChem CID 145131676) has the molecular formula C20H38N3O3+ and a molecular weight of 368.54 g/mol. Its IUPAC name is butyl-[2-[[3-(cyanatomethyl)-3,5,5-trimethylcyclohexyl]carbamoyloxy]ethyl]-dimethylazanium.
| Compound Name | butyl-[2-[[3-(cyanatomethyl)-3,5,5-trimethylcyclohexyl]carbamoyloxy]ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 145131676 |
| Molecular Formula | C20H38N3O3+ |
| Molecular Weight | 368.54 g/mol |
| Exact Mass | 368.29 |
| IUPAC Name | butyl-[2-[[3-(cyanatomethyl)-3,5,5-trimethylcyclohexyl]carbamoyloxy]ethyl]-dimethylazanium |
| SMILES | CCCC[N+](C)(C)CCOC(=O)NC1CC(C)(C)CC(C)(COC#N)C1 |
| InChI | InChI=1S/C20H37N3O3/c1-7-8-9-23(5,6)10-11-26-18(24)22-17-12-19(2,3)14-20(4,13-17)15-25-16-21/h17H,7-15H2,1-6H3/p+1 |
| InChIKey | AFVGUOGKMULAIB-UHFFFAOYSA-O |
| XLogP | 3.67 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.54 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|