C35H53N3O11 — CID 20652668
2-[[3-[2,3-dioxo-3-[[3,3,5-trimethyl-5-[2-(2-methylprop-2-enoyloxy)ethoxycarbonylamino]cyclohexyl]amino]propanoyl]-3,5,5-trimethylcyclohexyl]carbamoyloxy]ethyl 2-methylprop-2-enoate (PubChem CID 20652668) has the molecular formula C35H53N3O11 and a molecular weight of 691.82 g/mol. Its IUPAC name is 2-[[3-[2,3-dioxo-3-[[3,3,5-trimethyl-5-[2-(2-methylprop-2-enoyloxy)ethoxycarbonylamino]cyclohexyl]amino]propanoyl]-3,5,5-trimethylcyclohexyl]carbamoyloxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[[3-[2,3-dioxo-3-[[3,3,5-trimethyl-5-[2-(2-methylprop-2-enoyloxy)ethoxycarbonylamino]cyclohexyl]amino]propanoyl]-3,5,5-trimethylcyclohexyl]carbamoyloxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 20652668 |
| Molecular Formula | C35H53N3O11 |
| Molecular Weight | 691.82 g/mol |
| Exact Mass | 691.37 |
| IUPAC Name | 2-[[3-[2,3-dioxo-3-[[3,3,5-trimethyl-5-[2-(2-methylprop-2-enoyloxy)ethoxycarbonylamino]cyclohexyl]amino]propanoyl]-3,5,5-trimethylcyclohexyl]carbamoyloxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOC(=O)NC1CC(C)(C)CC(C)(C(=O)C(=O)C(=O)NC2CC(C)(C)CC(C)(NC(=O)OCCOC(=O)C(=C)C)C2)C1 |
| InChI | InChI=1S/C35H53N3O11/c1-21(2)28(42)46-11-13-48-30(44)37-23-15-32(5,6)19-34(9,17-23)26(40)25(39)27(41)36-24-16-33(7,8)20-35(10,18-24)38-31(45)49-14-12-47-29(43)22(3)4/h23-24H,1,3,11-20H2,2,4-10H3,(H,36,41)(H,37,44)(H,38,45) |
| InChIKey | QLKGUHSPIVNTTN-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 192.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.82 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|