C19H22F12N2O3 — CID 102500143
[2,3,4,5,5,5-hexafluoro-2,4-bis(trifluoromethyl)pentyl] N-[3-(isocyanatomethyl)-3,5,5-trimethylcyclohexyl]carbamate (PubChem CID 102500143) has the molecular formula C19H22F12N2O3 and a molecular weight of 554.37 g/mol. Its IUPAC name is [2,3,4,5,5,5-hexafluoro-2,4-bis(trifluoromethyl)pentyl] N-[3-(isocyanatomethyl)-3,5,5-trimethylcyclohexyl]carbamate.
| Compound Name | [2,3,4,5,5,5-hexafluoro-2,4-bis(trifluoromethyl)pentyl] N-[3-(isocyanatomethyl)-3,5,5-trimethylcyclohexyl]carbamate |
|---|---|
| PubChem CID | 102500143 |
| Molecular Formula | C19H22F12N2O3 |
| Molecular Weight | 554.37 g/mol |
| Exact Mass | 554.14 |
| IUPAC Name | [2,3,4,5,5,5-hexafluoro-2,4-bis(trifluoromethyl)pentyl] N-[3-(isocyanatomethyl)-3,5,5-trimethylcyclohexyl]carbamate |
| SMILES | CC1(C)CC(NC(=O)OCC(F)(C(F)C(F)(C(F)(F)F)C(F)(F)F)C(F)(F)F)CC(C)(CN=C=O)C1 |
| InChI | InChI=1S/C19H22F12N2O3/c1-13(2)4-10(5-14(3,6-13)7-32-9-34)33-12(35)36-8-15(21,17(23,24)25)11(20)16(22,18(26,27)28)19(29,30)31/h10-11H,4-8H2,1-3H3,(H,33,35) |
| InChIKey | JFFUKDPCUMACLV-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.37 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|