C14H22N2O4 — CID 160785283
acetic acid;5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethylcyclohexane (PubChem CID 160785283) has the molecular formula C14H22N2O4 and a molecular weight of 282.34 g/mol. Its IUPAC name is acetic acid;5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethylcyclohexane.
| Compound Name | acetic acid;5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethylcyclohexane |
|---|---|
| PubChem CID | 160785283 |
| Molecular Formula | C14H22N2O4 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | acetic acid;5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethylcyclohexane |
| SMILES | CC(=O)O.CC1(C)CC(N=C=O)CC(C)(CN=C=O)C1 |
| InChI | InChI=1S/C12H18N2O2.C2H4O2/c1-11(2)4-10(14-9-16)5-12(3,6-11)7-13-8-15;1-2(3)4/h10H,4-7H2,1-3H3;1H3,(H,3,4) |
| InChIKey | SBCUGEFDLNQFPS-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 96.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|