C20H26N6O6 — CID 160941291
1,1-diisocyanatoethane;1,2-diisocyanatoethane;5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethylcyclohexane (PubChem CID 160941291) has the molecular formula C20H26N6O6 and a molecular weight of 446.46 g/mol. Its IUPAC name is 1,1-diisocyanatoethane;1,2-diisocyanatoethane;5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethylcyclohexane.
| Compound Name | 1,1-diisocyanatoethane;1,2-diisocyanatoethane;5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethylcyclohexane |
|---|---|
| PubChem CID | 160941291 |
| Molecular Formula | C20H26N6O6 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | 1,1-diisocyanatoethane;1,2-diisocyanatoethane;5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethylcyclohexane |
| SMILES | CC(N=C=O)N=C=O.CC1(C)CC(N=C=O)CC(C)(CN=C=O)C1.O=C=NCCN=C=O |
| InChI | InChI=1S/C12H18N2O2.2C4H4N2O2/c1-11(2)4-10(14-9-16)5-12(3,6-11)7-13-8-15;1-4(5-2-7)6-3-8;7-3-5-1-2-6-4-8/h10H,4-7H2,1-3H3;4H,1H3;1-2H2 |
| InChIKey | SUNRWNQZAUAOTM-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 176.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|