C27H44N4O4 — CID 172699029
cyclohexylmethylcyclohexane;5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethylcyclohexane;isocyanic acid (PubChem CID 172699029) has the molecular formula C27H44N4O4 and a molecular weight of 488.67 g/mol. Its IUPAC name is cyclohexylmethylcyclohexane;5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethylcyclohexane;isocyanic acid.
| Compound Name | cyclohexylmethylcyclohexane;5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethylcyclohexane;isocyanic acid |
|---|---|
| PubChem CID | 172699029 |
| Molecular Formula | C27H44N4O4 |
| Molecular Weight | 488.67 g/mol |
| Exact Mass | 488.34 |
| IUPAC Name | cyclohexylmethylcyclohexane;5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethylcyclohexane;isocyanic acid |
| SMILES | C1CCC(CC2CCCCC2)CC1.CC1(C)CC(N=C=O)CC(C)(CN=C=O)C1.N=C=O.N=C=O |
| InChI | InChI=1S/C13H24.C12H18N2O2.2CHNO/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;1-11(2)4-10(14-9-16)5-12(3,6-11)7-13-8-15;2*2-1-3/h12-13H,1-11H2;10H,4-7H2,1-3H3;2*2H |
| InChIKey | CSCZEKXHKVLIMX-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 140.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.67 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|