C18H32N2O4 — CID 170851602
hexane-1,1-diol;5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethylcyclohexane (PubChem CID 170851602) has the molecular formula C18H32N2O4 and a molecular weight of 340.46 g/mol. Its IUPAC name is hexane-1,1-diol;5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethylcyclohexane.
| Compound Name | hexane-1,1-diol;5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethylcyclohexane |
|---|---|
| PubChem CID | 170851602 |
| Molecular Formula | C18H32N2O4 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | hexane-1,1-diol;5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethylcyclohexane |
| SMILES | CC1(C)CC(N=C=O)CC(C)(CN=C=O)C1.CCCCCC(O)O |
| InChI | InChI=1S/C12H18N2O2.C6H14O2/c1-11(2)4-10(14-9-16)5-12(3,6-11)7-13-8-15;1-2-3-4-5-6(7)8/h10H,4-7H2,1-3H3;6-8H,2-5H2,1H3 |
| InChIKey | WSUZINFGUHIXDR-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 99.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|