C30H57N3O7Si — CID 140673206
[1-oxo-1-(3-trimethoxysilylpropylamino)dodecan-4-yl] N-[(5-isocyanato-1,3,3-trimethylcyclohexyl)methyl]carbamate (PubChem CID 140673206) has the molecular formula C30H57N3O7Si and a molecular weight of 599.89 g/mol. Its IUPAC name is [1-oxo-1-(3-trimethoxysilylpropylamino)dodecan-4-yl] N-[(5-isocyanato-1,3,3-trimethylcyclohexyl)methyl]carbamate.
| Compound Name | [1-oxo-1-(3-trimethoxysilylpropylamino)dodecan-4-yl] N-[(5-isocyanato-1,3,3-trimethylcyclohexyl)methyl]carbamate |
|---|---|
| PubChem CID | 140673206 |
| Molecular Formula | C30H57N3O7Si |
| Molecular Weight | 599.89 g/mol |
| Exact Mass | 599.40 |
| IUPAC Name | [1-oxo-1-(3-trimethoxysilylpropylamino)dodecan-4-yl] N-[(5-isocyanato-1,3,3-trimethylcyclohexyl)methyl]carbamate |
| SMILES | CCCCCCCCC(CCC(=O)NCCC[Si](OC)(OC)OC)OC(=O)NCC1(C)CC(N=C=O)CC(C)(C)C1 |
| InChI | InChI=1S/C30H57N3O7Si/c1-8-9-10-11-12-13-15-26(16-17-27(35)31-18-14-19-41(37-5,38-6)39-7)40-28(36)32-23-30(4)21-25(33-24-34)20-29(2,3)22-30/h25-26H,8-23H2,1-7H3,(H,31,35)(H,32,36) |
| InChIKey | JQNDNHXUIWIWKC-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 124.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.89 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|