C15H24N2O4 — CID 59804592
oxiran-2-ylmethyl N-[(5-isocyanato-1,3,3-trimethylcyclohexyl)methyl]carbamate (PubChem CID 59804592) has the molecular formula C15H24N2O4 and a molecular weight of 296.37 g/mol. Its IUPAC name is oxiran-2-ylmethyl N-[(5-isocyanato-1,3,3-trimethylcyclohexyl)methyl]carbamate.
| Compound Name | oxiran-2-ylmethyl N-[(5-isocyanato-1,3,3-trimethylcyclohexyl)methyl]carbamate |
|---|---|
| PubChem CID | 59804592 |
| Molecular Formula | C15H24N2O4 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | oxiran-2-ylmethyl N-[(5-isocyanato-1,3,3-trimethylcyclohexyl)methyl]carbamate |
| SMILES | CC1(C)CC(N=C=O)CC(C)(CNC(=O)OCC2CO2)C1 |
| InChI | InChI=1S/C15H24N2O4/c1-14(2)4-11(17-10-18)5-15(3,8-14)9-16-13(19)21-7-12-6-20-12/h11-12H,4-9H2,1-3H3,(H,16,19) |
| InChIKey | JRRYSQFWACYBLU-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 80.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|