About sulfanyl N-[(5-isocyanato-1,3,3-trimethylcyclohexyl)methyl]carbamate
sulfanyl N-[(5-isocyanato-1,3,3-trimethylcyclohexyl)methyl]carbamate (PubChem CID 129206540) has the molecular formula C12H20N2O3S
and a molecular weight of 272.37 g/mol. Its IUPAC name is sulfanyl N-[(5-isocyanato-1,3,3-trimethylcyclohexyl)methyl]carbamate.
Molecular Properties
| Compound Name | sulfanyl N-[(5-isocyanato-1,3,3-trimethylcyclohexyl)methyl]carbamate |
| PubChem CID | 129206540 |
| Molecular Formula | C12H20N2O3S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | sulfanyl N-[(5-isocyanato-1,3,3-trimethylcyclohexyl)methyl]carbamate |
| SMILES | CC1(C)CC(N=C=O)CC(C)(CNC(=O)OS)C1 |
| InChI | InChI=1S/C12H20N2O3S/c1-11(2)4-9(14-8-15)5-12(3,6-11)7-13-10(16)17-18/h9,18H,4-7H2,1-3H3,(H,13,16) |
| InChIKey | LGNLISSJISKVCU-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze sulfanyl N-[(5-isocyanato-1,3,3-trimethylcyclohexyl)methyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sulfanyl N-[(5-isocyanato-1,3,3-trimethylcyclohexyl)methyl]carbamate?
The IUPAC name of sulfanyl N-[(5-isocyanato-1,3,3-trimethylcyclohexyl)methyl]carbamate (CID 129206540) is sulfanyl N-[(5-isocyanato-1,3,3-trimethylcyclohexyl)methyl]carbamate.
What is the SMILES notation for sulfanyl N-[(5-isocyanato-1,3,3-trimethylcyclohexyl)methyl]carbamate?
The canonical SMILES for sulfanyl N-[(5-isocyanato-1,3,3-trimethylcyclohexyl)methyl]carbamate is CC1(C)CC(N=C=O)CC(C)(CNC(=O)OS)C1.
What is the InChIKey of sulfanyl N-[(5-isocyanato-1,3,3-trimethylcyclohexyl)methyl]carbamate?
The InChIKey is LGNLISSJISKVCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2O3S/c1-11(2)4-9(14-8-15)5-12(3,6-11)7-13-10(16)17-18/h9,18H,4-7H2,1-3H3,(H,13,16).
What are the key properties of sulfanyl N-[(5-isocyanato-1,3,3-trimethylcyclohexyl)methyl]carbamate?
sulfanyl N-[(5-isocyanato-1,3,3-trimethylcyclohexyl)methyl]carbamate has a molecular weight of 272.37 g/mol, XLogP of 2.48, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sulfanyl N-[(5-isocyanato-1,3,3-trimethylcyclohexyl)methyl]carbamate is sourced from PubChem (CID 129206540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).