C13H21NO2 — CID 89264608
3-(5-isocyanato-1,3,3-trimethylcyclohexyl)propanal (PubChem CID 89264608) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is 3-(5-isocyanato-1,3,3-trimethylcyclohexyl)propanal.
| Compound Name | 3-(5-isocyanato-1,3,3-trimethylcyclohexyl)propanal |
|---|---|
| PubChem CID | 89264608 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | 3-(5-isocyanato-1,3,3-trimethylcyclohexyl)propanal |
| SMILES | CC1(C)CC(N=C=O)CC(C)(CCC=O)C1 |
| InChI | InChI=1S/C13H21NO2/c1-12(2)7-11(14-10-16)8-13(3,9-12)5-4-6-15/h6,11H,4-5,7-9H2,1-3H3 |
| InChIKey | JIVLJKABSWOBHZ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|