C21H41N3O4Si — CID 123869040
oxiran-2-ylmethyl N-[[1,3,3-trimethyl-5-[[methyl(3-methylsilylbutyl)carbamoyl]amino]cyclohexyl]methyl]carbamate (PubChem CID 123869040) has the molecular formula C21H41N3O4Si and a molecular weight of 427.66 g/mol. Its IUPAC name is oxiran-2-ylmethyl N-[[1,3,3-trimethyl-5-[[methyl(3-methylsilylbutyl)carbamoyl]amino]cyclohexyl]methyl]carbamate.
| Compound Name | oxiran-2-ylmethyl N-[[1,3,3-trimethyl-5-[[methyl(3-methylsilylbutyl)carbamoyl]amino]cyclohexyl]methyl]carbamate |
|---|---|
| PubChem CID | 123869040 |
| Molecular Formula | C21H41N3O4Si |
| Molecular Weight | 427.66 g/mol |
| Exact Mass | 427.29 |
| IUPAC Name | oxiran-2-ylmethyl N-[[1,3,3-trimethyl-5-[[methyl(3-methylsilylbutyl)carbamoyl]amino]cyclohexyl]methyl]carbamate |
| SMILES | C[SiH2]C(C)CCN(C)C(=O)NC1CC(C)(C)CC(C)(CNC(=O)OCC2CO2)C1 |
| InChI | InChI=1S/C21H41N3O4Si/c1-15(29-6)7-8-24(5)18(25)23-16-9-20(2,3)13-21(4,10-16)14-22-19(26)28-12-17-11-27-17/h15-17H,7-14,29H2,1-6H3,(H,22,26)(H,23,25) |
| InChIKey | JRTVPYRNSAHFAN-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 83.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.66 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|